EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O2 |
| Net Charge | 0 |
| Average Mass | 296.495 |
| Monoisotopic Mass | 296.27153 |
| SMILES | CCCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C19H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h10-11H,2-9,12-18H2,1H3,(H,20,21)/b11-10- |
| InChIKey | YOKHLRHWEXTWJR-KHPPLWFESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-9-nonadecenoic acid (CHEBI:78443) has role antineoplastic agent (CHEBI:35610) |
| cis-9-nonadecenoic acid (CHEBI:78443) has role apoptosis inducer (CHEBI:68495) |
| cis-9-nonadecenoic acid (CHEBI:78443) has role fungal metabolite (CHEBI:76946) |
| cis-9-nonadecenoic acid (CHEBI:78443) is a long-chain fatty acid (CHEBI:15904) |
| cis-9-nonadecenoic acid (CHEBI:78443) is a monounsaturated fatty acid (CHEBI:25413) |
| cis-9-nonadecenoic acid (CHEBI:78443) is a straight-chain fatty acid (CHEBI:59202) |
| IUPAC Name |
|---|
| (9Z)-nonadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 9Z-nonadecenoic acid | LIPID MAPS |
| 19:1(9Z) | LIPID MAPS |
| C19:1n-10 | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030886 | LIPID MAPS |
| Citations |
|---|