EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40O15 |
| Net Charge | 0 |
| Average Mass | 676.668 |
| Monoisotopic Mass | 676.23672 |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c3c(=O)c2O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C33H40O15/c1-13(2)5-10-17-19(45-33-28(42)26(40)23(37)20(12-34)46-33)11-18(35)21-24(38)31(48-32-27(41)25(39)22(36)14(3)44-32)29(47-30(17)21)15-6-8-16(43-4)9-7-15/h5-9,11,14,20,22-23,25-28,32-37,39-42H,10,12H2,1-4H3/t14-,20+,22-,23+,25+,26-,27+,28+,32-,33+/m0/s1 |
| InChIKey | TZJALUIVHRYQQB-XLRXWWTNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor that blocks the action of 3',5'-cyclic-GMP phosphodiesterase (EC 3.1.4.35). |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icariin (CHEBI:78420) has role antioxidant (CHEBI:22586) |
| icariin (CHEBI:78420) has role bone density conservation agent (CHEBI:50646) |
| icariin (CHEBI:78420) has role EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor (CHEBI:71942) |
| icariin (CHEBI:78420) has role phytoestrogen (CHEBI:76989) |
| icariin (CHEBI:78420) is a flavonols (CHEBI:28802) |
| icariin (CHEBI:78420) is a glycosyloxyflavone (CHEBI:50018) |
| IUPAC Name |
|---|
| 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| ieariline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Icariin | Wikipedia |
| C17555 | KEGG COMPOUND |
| LMPK12112009 | LIPID MAPS |
| LSM-3462 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:76280 | Reaxys |
| CAS:489-32-7 | ChemIDplus |
| CAS:489-32-7 | KEGG COMPOUND |
| Citations |
|---|