EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N3O3 |
| Net Charge | 0 |
| Average Mass | 279.340 |
| Monoisotopic Mass | 279.15829 |
| SMILES | CC(C)NC[C@@H]1CCc2cc(CO)c([N+](=O)[O-])cc2N1 |
| InChI | InChI=1S/C14H21N3O3/c1-9(2)15-7-12-4-3-10-5-11(8-18)14(17(19)20)6-13(10)16-12/h5-6,9,12,15-16,18H,3-4,7-8H2,1-2H3/t12-/m0/s1 |
| InChIKey | XCGYUJZMCCFSRP-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-oxamniquine (CHEBI:78418) is a {2-[(isopropylamino)methyl]-7-nitro-1,2,3,4-tetrahydroquinolin-6-yl}methanol (CHEBI:78416) |
| (S)-oxamniquine (CHEBI:78418) is enantiomer of (R)-oxamniquine (CHEBI:78417) |
| Incoming Relation(s) |
| oxamniquine (CHEBI:7819) has part (S)-oxamniquine (CHEBI:78418) |
| (R)-oxamniquine (CHEBI:78417) is enantiomer of (S)-oxamniquine (CHEBI:78418) |
| IUPAC Name |
|---|
| {(2S)-2-[(isopropylamino)methyl]-7-nitro-1,2,3,4-tetrahydroquinolin-6-yl}methanol |
| Synonym | Source |
|---|---|
| (2S)-1,2,3,4-tetrahydro-2-{[(1-methylethyl)amino]methyl}-7-nitro-6-quinolinemethanol | ChEBI |
| Citations |
|---|