EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25ClN6O4S |
| Net Charge | 0 |
| Average Mass | 505.000 |
| Monoisotopic Mass | 504.13465 |
| SMILES | COc1cc(N2CCOCC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C22H25ClN6O4S/c1-32-20-13-15(29-9-11-33-12-10-29)7-8-19(20)26-22-24-14-16(23)21(27-22)25-17-5-3-4-6-18(17)28-34(2,30)31/h3-8,13-14,28H,9-12H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | CLGWUCNXOBLWFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CZC-25146 (CHEBI:78414) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| CZC-25146 (CHEBI:78414) is a aminopyrimidine (CHEBI:38338) |
| CZC-25146 (CHEBI:78414) is a aromatic ether (CHEBI:35618) |
| CZC-25146 (CHEBI:78414) is a morpholines (CHEBI:38785) |
| CZC-25146 (CHEBI:78414) is a organochlorine compound (CHEBI:36683) |
| CZC-25146 (CHEBI:78414) is a secondary amino compound (CHEBI:50995) |
| CZC-25146 (CHEBI:78414) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-{2-[(5-chloro-2-{[2-methoxy-4-(morpholin-4-yl)phenyl]amino}pyrimidin-4-yl)amino]phenyl}methanesulfonamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19687577 | Reaxys |
| Citations |
|---|