EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O3 |
| Net Charge | 0 |
| Average Mass | 180.203 |
| Monoisotopic Mass | 180.07864 |
| SMILES | CCOC(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
| InChIKey | SAXHIDRUJXPDOD-SECBINFHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl (2R)-hydroxy(phenyl)acetate (CHEBI:78406) is a ethyl hydroxy(phenyl)acetate (CHEBI:38750) |
| ethyl (2R)-hydroxy(phenyl)acetate (CHEBI:78406) is enantiomer of ethyl (2S)-hydroxy(phenyl)acetate (CHEBI:78405) |
| Incoming Relation(s) |
| ethyl mandelate (CHEBI:78407) has part ethyl (2R)-hydroxy(phenyl)acetate (CHEBI:78406) |
| ethyl (2S)-hydroxy(phenyl)acetate (CHEBI:78405) is enantiomer of ethyl (2R)-hydroxy(phenyl)acetate (CHEBI:78406) |
| IUPAC Name |
|---|
| ethyl (2R)-hydroxy(phenyl)acetate |
| Synonyms | Source |
|---|---|
| ethyl (R)-(−)-2-hydroxy-2-phenylacetate | ChEBI |
| ethyl-(R)-mandelate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3200002 | Reaxys |
| CAS:10606-72-1 | ChemIDplus |