EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O |
| Net Charge | 0 |
| Average Mass | 146.189 |
| Monoisotopic Mass | 146.07316 |
| SMILES | CC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3/b8-7+ |
| InChIKey | BWHOZHOGCMHOBV-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). flavouring agent A food additive that is used to added improve the taste or odour of a food. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-benzylideneacetone (CHEBI:78399) has role bacterial metabolite (CHEBI:76969) |
| trans-benzylideneacetone (CHEBI:78399) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| trans-benzylideneacetone (CHEBI:78399) has role flavouring agent (CHEBI:35617) |
| trans-benzylideneacetone (CHEBI:78399) has role fragrance (CHEBI:48318) |
| trans-benzylideneacetone (CHEBI:78399) is a benzylideneacetone (CHEBI:217301) |
| IUPAC Name |
|---|
| (3E)-4-phenylbut-3-en-2-one |
| Synonyms | Source |
|---|---|
| Methyl trans-styryl ketone | ChemIDplus |
| trans-4-Phenyl-3-butene-2-one | ChemIDplus |
| trans-Benzalacetone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031617 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:742047 | Reaxys |
| CAS:1896-62-4 | ChemIDplus |
| Citations |
|---|