EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N4O7 |
| Net Charge | 0 |
| Average Mass | 330.297 |
| Monoisotopic Mass | 330.11755 |
| SMILES | CC(=O)/C=N/c1c(NC[C@H](O)[C@H](O)[C@H](O)CO)nc(=O)nc1=O |
| InChI | InChI=1S/C12H18N4O7/c1-5(18)2-13-8-10(15-12(23)16-11(8)22)14-3-6(19)9(21)7(20)4-17/h2,6-7,9,17,19-21H,3-4H2,1H3,(H3,14,15,16,22,23)/b13-2+/t6-,7+,9-/m0/s1 |
| InChIKey | LXKLTDXEFFOBPT-CEKOQDAHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(2-oxopropylideneamino)-6-D-ribitylaminouracil (CHEBI:78398) has role antigen (CHEBI:59132) |
| 5-(2-oxopropylideneamino)-6-D-ribitylaminouracil (CHEBI:78398) is a aminouracil (CHEBI:22532) |
| IUPAC Name |
|---|
| 1-deoxy-1-({2,6-dioxo-5-[(EE)-(2-oxopropylidene)amino]-1,2,3,6-tetrahydropyrimidin-4-yl}amino)-D-ribitol |
| Synonym | Source |
|---|---|
| 5-OP-RU | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-(2-oxopropylideneamino)-6-(D-ribitylamino)uracil | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2LJ | PDBeChem |
| Citations |
|---|