EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O7 |
| Net Charge | 0 |
| Average Mass | 316.270 |
| Monoisotopic Mass | 316.10190 |
| SMILES | [H]C(=O)/C=N/c1c(NC[C@H](O)[C@H](O)[C@H](O)CO)nc(=O)nc1=O |
| InChI | InChI=1S/C11H16N4O7/c16-2-1-12-7-9(14-11(22)15-10(7)21)13-3-5(18)8(20)6(19)4-17/h1-2,5-6,8,17-20H,3-4H2,(H3,13,14,15,21,22)/b12-1+/t5-,6+,8-/m0/s1 |
| InChIKey | PUEQUELBQOQOOV-GJQDMXJLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(2-oxoethylideneamino)-6-D-ribitylaminouracil (CHEBI:78397) has role antigen (CHEBI:59132) |
| 5-(2-oxoethylideneamino)-6-D-ribitylaminouracil (CHEBI:78397) is a aminouracil (CHEBI:22532) |
| IUPAC Name |
|---|
| 1-deoxy-1-({2,6-dioxo-5-[(E)-(2-oxoethylidene)amino]-1,2,3,6-tetrahydropyrimidin-4-yl}amino)-D-ribitol |
| Synonym | Source |
|---|---|
| 5-OE-RU | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-(2-oxoethylideneamino)-6-(D-ribitylamino)uracil | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2L4 | PDBeChem |
| Citations |
|---|