EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO |
| Net Charge | 0 |
| Average Mass | 309.453 |
| Monoisotopic Mass | 309.20926 |
| SMILES | C[C@@H](COc1ccccc1Cc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C21H27NO/c1-18(22-14-8-3-9-15-22)17-23-21-13-7-6-12-20(21)16-19-10-4-2-5-11-19/h2,4-7,10-13,18H,3,8-9,14-17H2,1H3/t18-/m0/s1 |
| InChIKey | JTUQXGZRVLWBCR-SFHVURJKSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-benproperine (CHEBI:78389) is a 1-[1-(2-benzylphenoxy)propan-2-yl]piperidine (CHEBI:78386) |
| (S)-benproperine (CHEBI:78389) is conjugate base of (S)-benproperine(1+) (CHEBI:78392) |
| (S)-benproperine (CHEBI:78389) is enantiomer of (R)-benproperine (CHEBI:78388) |
| Incoming Relation(s) |
| benproperine (CHEBI:37560) has part (S)-benproperine (CHEBI:78389) |
| (S)-benproperine(1+) (CHEBI:78392) is conjugate acid of (S)-benproperine (CHEBI:78389) |
| (R)-benproperine (CHEBI:78388) is enantiomer of (S)-benproperine (CHEBI:78389) |
| IUPAC Name |
|---|
| 1-[(2S)-1-(2-benzylphenoxy)propan-2-yl]piperidine |
| Synonyms | Source |
|---|---|
| (S)-(−)-benproperine | ChEBI |
| (−)-benproperine | ChEBI |
| Citations |
|---|