EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O3 |
| Net Charge | 0 |
| Average Mass | 222.244 |
| Monoisotopic Mass | 222.10044 |
| SMILES | [NH3+][C@@H](CCC(=O)Nc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C11H14N2O3/c12-9(11(15)16)6-7-10(14)13-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | VMNRUJGOLBSEPK-VIFPVBQESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-phenyl-L-glutamine zwitterion (CHEBI:78375) is a amino-acid zwitterion (CHEBI:35238) |
| N5-phenyl-L-glutamine zwitterion (CHEBI:78375) is tautomer of N5-phenyl-L-glutamine (CHEBI:79289) |
| Incoming Relation(s) |
| N5-phenyl-L-glutamine (CHEBI:79289) is tautomer of N5-phenyl-L-glutamine zwitterion (CHEBI:78375) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-anilino-5-oxopentanoate |
| UniProt Name | Source |
|---|---|
| N5-phenyl-L-glutamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15475 | MetaCyc |
| Citations |
|---|