EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:78373 - chelerythrine
| Formula | C21H18NO4 |
| Net Charge | +1 |
| Average Mass | 348.378 |
| Monoisotopic Mass | 348.12303 |
| SMILES | COc1ccc2c(c[n+](C)c3c4cc5c(cc4ccc23)OCO5)c1OC |
| InChI | InChI=1S/C21H18NO4/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22/h4-10H,11H2,1-3H3/q+1 |
| InChIKey | LLEJIEBFSOEYIV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chelerythrine (CHEBI:78373) has role antibacterial agent (CHEBI:33282) |
| chelerythrine (CHEBI:78373) has role antineoplastic agent (CHEBI:35610) |
| chelerythrine (CHEBI:78373) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| chelerythrine (CHEBI:78373) is a benzophenanthridine alkaloid (CHEBI:38517) |
| chelerythrine (CHEBI:78373) is a organic cation (CHEBI:25697) |
| IUPAC Name |
|---|
| 1,2-dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
| Synonym | Source |
|---|---|
| 1,2-Dimethoxy-12-methyl(1,3)benzodioxolo(5,6-c)phenanthridinium | ChemIDplus |
| UniProt Name | Source |
|---|---|
| chelerythrine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3915260 | Reaxys |
| CAS:34316-15-9 | ChemIDplus |
| CAS:34316-15-9 | KEGG COMPOUND |
| Citations |
|---|