EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O3 |
| Net Charge | 0 |
| Average Mass | 322.489 |
| Monoisotopic Mass | 322.25079 |
| SMILES | [H][C@@]1(CO)C[C@@H](O)[C@]2([H])[C@]1([H])C[C@@]1(C)CC[C@H](C(C)C)/C1=C/C[C@]2(C)O |
| InChI | InChI=1S/C20H34O3/c1-12(2)14-5-7-19(3)10-15-13(11-21)9-17(22)18(15)20(4,23)8-6-16(14)19/h6,12-15,17-18,21-23H,5,7-11H2,1-4H3/b16-6-/t13-,14+,15+,17+,18-,19+,20-/m0/s1 |
| InChIKey | MSKFOQCDNOFJAT-VCRXIKTMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces melanosporofaciens (ncbitaxon:67327) | - | PubMed (1335449) | Strain: MI614-43F2 |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.5 (lysophospholipase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of the enzyme lysophospholipase (EC 3.1.1.5), which catalyses the release of fatty acids from lysophospholipids. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclooctatin (CHEBI:78370) has role bacterial metabolite (CHEBI:76969) |
| cyclooctatin (CHEBI:78370) has role EC 3.1.1.5 (lysophospholipase) inhibitor (CHEBI:78372) |
| cyclooctatin (CHEBI:78370) is a carbotricyclic compound (CHEBI:38032) |
| cyclooctatin (CHEBI:78370) is a diterpenoid (CHEBI:23849) |
| cyclooctatin (CHEBI:78370) is a primary alcohol (CHEBI:15734) |
| cyclooctatin (CHEBI:78370) is a secondary alcohol (CHEBI:35681) |
| cyclooctatin (CHEBI:78370) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| cyclooctat-9-en-5,7-diol (CHEBI:141020) has functional parent cyclooctatin (CHEBI:78370) |
| cyclooctat-9-en-7-ol (CHEBI:78352) has functional parent cyclooctatin (CHEBI:78370) |
| IUPAC Names |
|---|
| (1R,3R,3aS,4S,6Z,7R,9aR,10aR)-1-(hydroxymethyl)-4,9a-dimethyl-7-(propan-2-yl)-1,2,3,3a,4,5,7,8,9,9a,10,10a-dodecahydrodicyclopenta[a,d][8]annulene-3,4-diol |
| (1R,3R,3aS,4S,6Z,7R,9aR,10aR)-1-(hydroxymethyl)-4,9a-dimethyl-7-(propan-2-yl)-1,2,3,3a,4,5,7,8,9,9a,10,10a-dodecahydrodicyclopenta[a,d]cyclooctene-3,4-diol |
| Synonyms | Source |
|---|---|
| (1R,3R,3aS,4S,6Z,7R,9aR,10aR)-1-(hydroxymethyl)-7-isopropyl-4,9a-dimethyl-1,2,3,3a,4,5,7,8,9,9a,10,10a-dodecahydrodicyclopenta[a,d][8]annulene-3,4-diol | IUPAC |
| (1R,3R,3aS,4S,6Z,7R,9aR,10aR)-1-(hydroxymethyl)-7-isopropyl-4,9a-dimethyl-1,2,3,3a,4,5,7,8,9,9a,10,10a-dodecahydrodicyclopenta[a,d]cyclooctene-3,4-diol | IUPAC |
| UniProt Name | Source |
|---|---|
| cyclooctatin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16666 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31158120 | Reaxys |
| Citations |
|---|