EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H67N15O12S2 |
| Net Charge | 0 |
| Average Mass | 1050.236 |
| Monoisotopic Mass | 1049.45350 |
| SMILES | [H][C@@]1(C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(N)=O)CCCN1C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N1 |
| InChI | InChI=1S/C43H67N15O12S2/c1-3-21(2)34-41(69)53-26(12-13-31(45)60)37(65)55-28(17-32(46)61)38(66)56-29(20-72-71-19-24(44)35(63)54-27(39(67)57-34)16-22-8-10-23(59)11-9-22)42(70)58-15-5-7-30(58)40(68)52-25(6-4-14-50-43(48)49)36(64)51-18-33(47)62/h8-11,21,24-30,34,59H,3-7,12-20,44H2,1-2H3,(H2,45,60)(H2,46,61)(H2,47,62)(H,51,64)(H,52,68)(H,53,69)(H,54,63)(H,55,65)(H,56,66)(H,57,67)(H4,48,49,50)/t21-,24-,25-,26-,27-,28-,29-,30-,34-/m0/s1 |
| InChIKey | OXDZADMCOWPSOC-BQGUCLBMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vasotocin (CHEBI:78364) has role animal metabolite (CHEBI:75767) |
| vasotocin (CHEBI:78364) is a heterodetic cyclic peptide (CHEBI:24533) |
| vasotocin (CHEBI:78364) is a peptide hormone (CHEBI:25905) |
| IUPAC Name |
|---|
| 1-{[(4R,7S,10S,13S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-butan-2-yl]-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-arginylglycinamide |
| INNs | Source |
|---|---|
| argiprestocin | WHO MedNet |
| argiprestocina | WHO MedNet |
| argiprestocine | WHO MedNet |
| argiprestocinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| [8-arginine]-oxytocin | ChEBI |
| 8-Arg-vasotocin | ChemIDplus |
| arginine vasotocin | ChEBI |
| Arg-vasotocin | ChemIDplus |
| AVT | ChEBI |
| Citations |
|---|