EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O7 |
| Net Charge | 0 |
| Average Mass | 210.182 |
| Monoisotopic Mass | 210.07395 |
| SMILES | O=C(CO)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO1122h]/1/ |
| InChI | InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7+/m1/s1 |
| InChIKey | HSNZZMHEPUFJNZ-QMTIVRBISA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 2.7.1.1 (hexokinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of hexokinase, EC 2.7.1.1, an enzyme that phosphorylates hexoses forming hexose phosphate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-keto-manno-heptulose (CHEBI:78363) is a D-manno-heptulose (CHEBI:78365) |
| IUPAC Name |
|---|
| (3S,4S,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one |