EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O7 |
| Net Charge | 0 |
| Average Mass | 210.182 |
| Monoisotopic Mass | 210.07395 |
| SMILES | O=C(CO)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO1122h]/1/ |
| InChI | InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7+/m1/s1 |
| InChIKey | HSNZZMHEPUFJNZ-QMTIVRBISA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.1 (hexokinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of hexokinase, EC 2.7.1.1, an enzyme that phosphorylates hexoses forming hexose phosphate. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-keto-manno-heptulose (CHEBI:78363) is a D-manno-heptulose (CHEBI:78365) |
| IUPAC Name |
|---|
| (3S,4S,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one |