EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C10H17N.H2O4S |
| Net Charge | 0 |
| Average Mass | 400.585 |
| Monoisotopic Mass | 400.23958 |
| SMILES | NC12CC3CC(CC(C3)C1)C2.NC12CC3CC(CC(C3)C1)C2.O=S(=O)(O)O |
| InChI | InChI=1S/2C10H17N.H2O4S/c2*11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-5(2,3)4/h2*7-9H,1-6,11H2;(H2,1,2,3,4) |
| InChIKey | MYWTWSQFJLXGGQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amantadine sulfate (CHEBI:78351) has part adamantan-1-aminium (CHEBI:48320) |
| amantadine sulfate (CHEBI:78351) has role antiparkinson drug (CHEBI:48407) |
| amantadine sulfate (CHEBI:78351) has role antiviral drug (CHEBI:36044) |
| amantadine sulfate (CHEBI:78351) has role dopaminergic agent (CHEBI:48560) |
| amantadine sulfate (CHEBI:78351) has role NMDA receptor antagonist (CHEBI:60643) |
| amantadine sulfate (CHEBI:78351) has role non-narcotic analgesic (CHEBI:35481) |
| amantadine sulfate (CHEBI:78351) is a alkylammonium sulfate (CHEBI:38015) |
| IUPAC Name |
|---|
| adamantan-1-amine sulfate |
| INN | Source |
|---|---|
| amantadine sulphate | ChemIDplus |
| Synonym | Source |
|---|---|
| Amantadine sulphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Amantadine | Wikipedia |
| DB00915 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:31377-23-8 | ChemIDplus |
| Citations |
|---|