EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27ClN4O4 |
| Net Charge | 0 |
| Average Mass | 458.946 |
| Monoisotopic Mass | 458.17208 |
| SMILES | COc1ccc(Cl)c(Nc2ncnc3cc(OCCCN4CCOCC4)c(OC)cc23)c1 |
| InChI | InChI=1S/C23H27ClN4O4/c1-29-16-4-5-18(24)20(12-16)27-23-17-13-21(30-2)22(14-19(17)25-15-26-23)32-9-3-6-28-7-10-31-11-8-28/h4-5,12-15H,3,6-11H2,1-2H3,(H,25,26,27) |
| InChIKey | CVOJFSBJHSHLQV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Src Inhibitor-5 (CHEBI:78344) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| Src Inhibitor-5 (CHEBI:78344) is a aromatic ether (CHEBI:35618) |
| Src Inhibitor-5 (CHEBI:78344) is a monochlorobenzenes (CHEBI:83403) |
| Src Inhibitor-5 (CHEBI:78344) is a morpholines (CHEBI:38785) |
| Src Inhibitor-5 (CHEBI:78344) is a polyether (CHEBI:46774) |
| Src Inhibitor-5 (CHEBI:78344) is a quinazolines (CHEBI:38530) |
| Src Inhibitor-5 (CHEBI:78344) is a secondary amino compound (CHEBI:50995) |
| Src Inhibitor-5 (CHEBI:78344) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(2-chloro-5-methoxyphenyl)-6-methoxy-7-[3-(morpholin-4-yl)propoxy]quinazolin-4-amine |
| Synonym | Source |
|---|---|
| 4-[(2-chloro-5-methoxyphenyl)amino]-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazoline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9667079 | Reaxys |