EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | [H]C(=O)c1cccc(OC)c1O |
| InChI | InChI=1S/C8H8O3/c1-11-7-4-2-3-6(5-9)8(7)10/h2-5,10H,1H3 |
| InChIKey | JJVNINGBHGBWJH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ortho-vanillin (CHEBI:78339) has functional parent salicylaldehyde (CHEBI:16008) |
| ortho-vanillin (CHEBI:78339) has role antimutagen (CHEBI:73190) |
| ortho-vanillin (CHEBI:78339) has role plant metabolite (CHEBI:76924) |
| ortho-vanillin (CHEBI:78339) is a benzaldehydes (CHEBI:22698) |
| ortho-vanillin (CHEBI:78339) is a guaiacols (CHEBI:134251) |
| IUPAC Name |
|---|
| 2-hydroxy-3-methoxybenzaldehyde |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-m-anisaldehyde | ChemIDplus |
| 2-Vanillin | ChemIDplus |
| 3-methoxysalicylaldehyde | ChEBI |
| 6-Formyl-2-methoxyphenol | ChemIDplus |
| 6-Formylguaiacol | ChemIDplus |
| Oxy-2 methoxy-3 benzaldehyde | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Ortho-Vanillin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:471913 | Reaxys |
| CAS:148-53-8 | ChemIDplus |
| Citations |
|---|