EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | O=C(O)C(CO)c1cccc(O)c1 |
| InChI | InChI=1S/C9H10O4/c10-5-8(9(12)13)6-2-1-3-7(11)4-6/h1-4,8,10-11H,5H2,(H,12,13) |
| InChIKey | DGBMCKWHCNMPPE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meta-hydroxyphenylhydracrylic acid (CHEBI:78336) has functional parent propionic acid (CHEBI:30768) |
| meta-hydroxyphenylhydracrylic acid (CHEBI:78336) has role human xenobiotic metabolite (CHEBI:76967) |
| meta-hydroxyphenylhydracrylic acid (CHEBI:78336) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| meta-hydroxyphenylhydracrylic acid (CHEBI:78336) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-hydroxy-2-(3-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| Meta-Hydroxyphenylhydracrylic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15405544 | Reaxys |
| Citations |
|---|