EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19N3O3 |
| Net Charge | 0 |
| Average Mass | 373.412 |
| Monoisotopic Mass | 373.14264 |
| SMILES | COc1cc2ncnc(Nc3ccc(Oc4ccccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C22H19N3O3/c1-26-20-12-18-19(13-21(20)27-2)23-14-24-22(18)25-15-8-10-17(11-9-15)28-16-6-4-3-5-7-16/h3-14H,1-2H3,(H,23,24,25) |
| InChIKey | DMWVGXGXHPOEPT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Src Inhibitor-1 (CHEBI:78332) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| Src Inhibitor-1 (CHEBI:78332) is a aromatic ether (CHEBI:35618) |
| Src Inhibitor-1 (CHEBI:78332) is a polyether (CHEBI:46774) |
| Src Inhibitor-1 (CHEBI:78332) is a quinazolines (CHEBI:38530) |
| Src Inhibitor-1 (CHEBI:78332) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 6,7-dimethoxy-N-(4-phenoxyphenyl)quinazolin-4-amine |
| Synonyms | Source |
|---|---|
| 4-(4'-phenoxyanilino)-6,7-dimethoxyquinazoline | ChEBI |
| (4'-oxyphenyl-phenylamino)-6,7-dimethoxyquinazoline | ChEBI |
| 6,7-dimethoxy-N-(4-phenoxyphenyl)-4-quinazolinamine | ChEBI |
| SKI-1 | ChEBI |
| Src kinase inhibitor I | ChEBI |
| Src-l1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-3112 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8790191 | Reaxys |
| Citations |
|---|