EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16ClN5 |
| Net Charge | 0 |
| Average Mass | 301.781 |
| Monoisotopic Mass | 301.10942 |
| SMILES | CC(C)(C)n1nc(-c2ccc(Cl)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C15H16ClN5/c1-15(2,3)21-14-11(13(17)18-8-19-14)12(20-21)9-4-6-10(16)7-5-9/h4-8H,1-3H3,(H2,17,18,19) |
| InChIKey | PBBRWFOVCUAONR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Applications: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PP2 (CHEBI:78331) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| PP2 (CHEBI:78331) has role geroprotector (CHEBI:176497) |
| PP2 (CHEBI:78331) has role β-adrenergic antagonist (CHEBI:35530) |
| PP2 (CHEBI:78331) is a aromatic amine (CHEBI:33860) |
| PP2 (CHEBI:78331) is a monochlorobenzenes (CHEBI:83403) |
| PP2 (CHEBI:78331) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| 1-tert-butyl-3-(4-chlorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| AG 1879 | ChEBI |
| AG-1879 | ChEBI |
| AG1879 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-4153 | LINCS |
| PP2 | PDBeChem |
| PP2_(kinase_inhibitor) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9409964 | Reaxys |
| CAS:172889-27-9 | ChEBI |
| Citations |
|---|