EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16ClN5 |
| Net Charge | 0 |
| Average Mass | 301.781 |
| Monoisotopic Mass | 301.10942 |
| SMILES | CC(C)(C)n1nc(-c2ccc(Cl)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C15H16ClN5/c1-15(2,3)21-14-11(13(17)18-8-19-14)12(20-21)9-4-6-10(16)7-5-9/h4-8H,1-3H3,(H2,17,18,19) |
| InChIKey | PBBRWFOVCUAONR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PP2 (CHEBI:78331) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| PP2 (CHEBI:78331) has role geroprotector (CHEBI:176497) |
| PP2 (CHEBI:78331) has role β-adrenergic antagonist (CHEBI:35530) |
| PP2 (CHEBI:78331) is a aromatic amine (CHEBI:33860) |
| PP2 (CHEBI:78331) is a monochlorobenzenes (CHEBI:83403) |
| PP2 (CHEBI:78331) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| 1-tert-butyl-3-(4-chlorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| AG 1879 | ChEBI |
| AG-1879 | ChEBI |
| AG1879 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-4153 | LINCS |
| PP2 | PDBeChem |
| PP2_(kinase_inhibitor) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9409964 | Reaxys |
| CAS:172889-27-9 | ChEBI |
| Citations |
|---|