EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O13 |
| Net Charge | 0 |
| Average Mass | 492.389 |
| Monoisotopic Mass | 492.09039 |
| SMILES | Cc1c(C(=O)O)c(O)cc2c1C(=O)c1c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c(O)c1C2=O |
| InChI | InChI=1S/C22H20O13/c1-4-8-5(2-6(24)9(4)22(33)34)13(25)10-11(15(8)27)16(28)12(18(30)17(10)29)21-20(32)19(31)14(26)7(3-23)35-21/h2,7,14,19-21,23-24,26,28-32H,3H2,1H3,(H,33,34)/t7-,14-,19+,20-,21+/m1/s1 |
| InChIKey | DGQLVPJVXFOQEV-JNVSTXMASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carminic acid (CHEBI:78310) has role animal metabolite (CHEBI:75767) |
| carminic acid (CHEBI:78310) has role histological dye (CHEBI:77178) |
| carminic acid (CHEBI:78310) is a C-glycosyl compound (CHEBI:20857) |
| carminic acid (CHEBI:78310) is a monocarboxylic acid (CHEBI:25384) |
| carminic acid (CHEBI:78310) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| carminic acid (CHEBI:78310) is conjugate acid of carminate(2−) (CHEBI:149531) |
| Incoming Relation(s) |
| carminate(2−) (CHEBI:149531) is conjugate base of carminic acid (CHEBI:78310) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(7-carboxy-1,3,4,6-tetrahydroxy-8-methyl-9,10-dioxo-9,10-dihydroanthracen-2-yl)-D-glucitol |
| Synonyms | Source |
|---|---|
| Carmine | KEGG COMPOUND |
| Sun Red 1 | HMDB |
| Natural red 4 | HMDB |
| Carmine red | HMDB |
| C.I. Natural Red 4 | HMDB |
| Coccinellin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11254 | KEGG COMPOUND |
| HMDB0030658 | HMDB |
| Carminic_acid | Wikipedia |
| FDB002568 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1414932 | Reaxys |
| CAS:1260-17-9 | KEGG COMPOUND |
| CAS:1260-17-9 | ChemIDplus |
| Citations |
|---|