EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45NO13 |
| Net Charge | 0 |
| Average Mass | 699.750 |
| Monoisotopic Mass | 699.28909 |
| SMILES | CC[C@@]1(O)C[C@H](O[C@H]2C[C@H]([NH+](C)C)[C@H](O[C@H]3C[C@H](O)[C@H](O)[C@H](C)O3)[C@H](C)O2)c2c(cc3c(c2[O-])C(=O)c2c(O)cccc2C3=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C36H45NO13/c1-7-36(45)14-23(49-24-12-20(37(4)5)34(16(3)48-24)50-25-13-22(39)30(40)15(2)47-25)27-18(29(36)35(44)46-6)11-19-28(33(27)43)32(42)26-17(31(19)41)9-8-10-21(26)38/h8-11,15-16,20,22-25,29-30,34,38-40,43,45H,7,12-14H2,1-6H3/t15-,16-,20-,22-,23-,24-,25-,29-,30+,34+,36+/m0/s1 |
| InChIKey | DNZPQXXGAMXDHH-FCNQEGBTSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclacinomycin S zwitterion (CHEBI:78303) has role antimicrobial agent (CHEBI:33281) |
| aclacinomycin S zwitterion (CHEBI:78303) has role antineoplastic agent (CHEBI:35610) |
| aclacinomycin S zwitterion (CHEBI:78303) has role bacterial metabolite (CHEBI:76969) |
| aclacinomycin S zwitterion (CHEBI:78303) is a zwitterion (CHEBI:27369) |
| aclacinomycin S zwitterion (CHEBI:78303) is tautomer of aclacinomycin S (CHEBI:79176) |
| Incoming Relation(s) |
| aclacinomycin S (CHEBI:79176) is tautomer of aclacinomycin S zwitterion (CHEBI:78303) |
| IUPAC Name |
|---|
| (1R,2R,4S)-2-ethyl-2,7-dihydroxy-1-(methoxycarbonyl)-6,11-dioxo-4-{[2,3,6-trideoxy-4-O-(2,6-dideoxy-α-L-lyxo-hexopyranosyl)-3-(dimethylazaniumyl)-α-L-lyxo-hexopyranosyl]oxy}-1,2,3,4,6,11-hexahydrotetracen-5-olate |
| UniProt Name | Source |
|---|---|
| aclacinomycin S | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15765 | MetaCyc |
| Citations |
|---|