EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12FeN2O8.Na |
| Net Charge | 0 |
| Average Mass | 367.047 |
| Monoisotopic Mass | 366.98407 |
| SMILES | O=C([O-])C[N+]12CC[N+]34CC(=O)[O][Fe-2]13([O]C(=O)C2)[O]C(=O)C4.[Na+] |
| InChI | InChI=1S/C10H16N2O8.Fe.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+3;+1/p-4 |
| InChIKey | MKWYFZFMAMBPQK-UHFFFAOYSA-J |
| Roles Classification |
|---|
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium feredetate (CHEBI:78292) has part iron(3+) (CHEBI:29034) |
| sodium feredetate (CHEBI:78292) has role anti-anaemic agent (CHEBI:75835) |
| sodium feredetate (CHEBI:78292) is a iron chelate (CHEBI:5975) |
| sodium feredetate (CHEBI:78292) is a organic sodium salt (CHEBI:38700) |
| IUPAC Names |
|---|
| iron(3+) sodium 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetate |
| sodium {2,2',2'',2'''-[ethane-1,2-diyldi(nitrilo-κN)]tetraacetato-κO(4−)}ferrate(1−) |
| INNs | Source |
|---|---|
| feredato de sodio | WHO MedNet |
| ferédétate de sodium | WHO MedNet |
| feredetato de sodio | WHO MedNet |
| natrii feredetas | ChemIDplus |
| sodium feredetate | ChemIDplus |
| Synonyms | Source |
|---|---|
| edathamil monosodium ferric salt | ChemIDplus |
| Edetic acid sodium iron salt | ChEMBL |
| Edta ferric sodium salt | ChEMBL |
| Edta, iron (iii) sodium | ChEMBL |
| Edta iron(iii) sodium salt | ChEMBL |
| Ferrazone | ChEMBL |
| Brand Name | Source |
|---|---|
| Calmosine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07145 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:15708-41-5 | ChemIDplus |
| CAS:15708-41-5 | KEGG DRUG |
| Citations |
|---|