EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36O15 |
| Net Charge | 0 |
| Average Mass | 660.625 |
| Monoisotopic Mass | 660.20542 |
| SMILES | COC(=O)c1c(O[C@@H]2O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]2OC)cc2cc3c(c(O)c2c1C)C(=O)[C@]1(OC)C(=O)C=C(OC)[C@@H](O)[C@]1(O)C3=O |
| InChI | InChI=1S/C32H36O15/c1-12-19-14(10-16(20(12)29(38)44-7)47-30-25(43-6)24(42-5)23(41-4)13(2)46-30)9-15-21(22(19)34)28(37)32(45-8)18(33)11-17(40-3)27(36)31(32,39)26(15)35/h9-11,13,23-25,27,30,34,36,39H,1-8H3/t13-,23-,24+,25+,27+,30-,31+,32+/m0/s1 |
| InChIKey | OYEXGNNKRQPUBW-FJYHMNRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces olivaceus (ncbitaxon:47716) | - | PubMed (11376004) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elloramycin A (CHEBI:78288) has functional parent tetracenomycin C (CHEBI:9470) |
| elloramycin A (CHEBI:78288) has role antimicrobial agent (CHEBI:33281) |
| elloramycin A (CHEBI:78288) has role bacterial metabolite (CHEBI:76969) |
| elloramycin A (CHEBI:78288) is a carboxylic ester (CHEBI:33308) |
| elloramycin A (CHEBI:78288) is a enol ether (CHEBI:47985) |
| elloramycin A (CHEBI:78288) is a enone (CHEBI:51689) |
| elloramycin A (CHEBI:78288) is a methyl ester (CHEBI:25248) |
| elloramycin A (CHEBI:78288) is a monosaccharide derivative (CHEBI:63367) |
| elloramycin A (CHEBI:78288) is a phenols (CHEBI:33853) |
| elloramycin A (CHEBI:78288) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| elloramycin A (CHEBI:78288) is a tetracenomycin (CHEBI:48132) |
| elloramycin A (CHEBI:78288) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| methyl (6aR,7S,10aR)-3-[(6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyl)oxy]-6a,7,12-trihydroxy-8,10a-dimethoxy-1-methyl-6,10,11-trioxo-6,6a,7,10,10a,11-hexahydrotetracene-2-carboxylate |
| Synonym | Source |
|---|---|
| Elloramycin | KNApSAcK |
| UniProt Name | Source |
|---|---|
| elloramycin A | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:97218-42-3 | ChemIDplus |
| CAS:97218-42-3 | KEGG COMPOUND |
| Citations |
|---|