EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36O15 |
| Net Charge | 0 |
| Average Mass | 660.625 |
| Monoisotopic Mass | 660.20542 |
| SMILES | COC(=O)c1c(O[C@@H]2O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]2OC)cc2cc3c(c(O)c2c1C)C(=O)[C@]1(OC)C(=O)C=C(OC)[C@@H](O)[C@]1(O)C3=O |
| InChI | InChI=1S/C32H36O15/c1-12-19-14(10-16(20(12)29(38)44-7)47-30-25(43-6)24(42-5)23(41-4)13(2)46-30)9-15-21(22(19)34)28(37)32(45-8)18(33)11-17(40-3)27(36)31(32,39)26(15)35/h9-11,13,23-25,27,30,34,36,39H,1-8H3/t13-,23-,24+,25+,27+,30-,31+,32+/m0/s1 |
| InChIKey | OYEXGNNKRQPUBW-FJYHMNRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces olivaceus (ncbitaxon:47716) | - | PubMed (11376004) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elloramycin A (CHEBI:78288) has functional parent tetracenomycin C (CHEBI:9470) |
| elloramycin A (CHEBI:78288) has role antimicrobial agent (CHEBI:33281) |
| elloramycin A (CHEBI:78288) has role bacterial metabolite (CHEBI:76969) |
| elloramycin A (CHEBI:78288) is a carboxylic ester (CHEBI:33308) |
| elloramycin A (CHEBI:78288) is a enol ether (CHEBI:47985) |
| elloramycin A (CHEBI:78288) is a enone (CHEBI:51689) |
| elloramycin A (CHEBI:78288) is a methyl ester (CHEBI:25248) |
| elloramycin A (CHEBI:78288) is a monosaccharide derivative (CHEBI:63367) |
| elloramycin A (CHEBI:78288) is a phenols (CHEBI:33853) |
| elloramycin A (CHEBI:78288) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| elloramycin A (CHEBI:78288) is a tetracenomycin (CHEBI:48132) |
| elloramycin A (CHEBI:78288) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| methyl (6aR,7S,10aR)-3-[(6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyl)oxy]-6a,7,12-trihydroxy-8,10a-dimethoxy-1-methyl-6,10,11-trioxo-6,6a,7,10,10a,11-hexahydrotetracene-2-carboxylate |
| Synonym | Source |
|---|---|
| Elloramycin | KNApSAcK |
| UniProt Name | Source |
|---|---|
| elloramycin A | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:97218-42-3 | KEGG COMPOUND |
| CAS:97218-42-3 | ChemIDplus |
| Citations |
|---|