EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H40O2 |
| Net Charge | 0 |
| Average Mass | 444.659 |
| Monoisotopic Mass | 444.30283 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC1=C(C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H40O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,12,14,16,18-20H,9-11,13,15,17,21H2,1-6H3/b23-14+,24-16+,25-20+ |
| InChIKey | DKHGMERMDICWDU-GHDNBGIDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000118) | PubMed (32086127) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| menaquinone-4 (CHEBI:78277) has role anti-inflammatory agent (CHEBI:67079) |
| menaquinone-4 (CHEBI:78277) has role antioxidant (CHEBI:22586) |
| menaquinone-4 (CHEBI:78277) has role bone density conservation agent (CHEBI:50646) |
| menaquinone-4 (CHEBI:78277) has role human metabolite (CHEBI:77746) |
| menaquinone-4 (CHEBI:78277) has role neuroprotective agent (CHEBI:63726) |
| menaquinone-4 (CHEBI:78277) is a menaquinone (CHEBI:16374) |
| Incoming Relation(s) |
| 2,3-epoxymenatetrenone (CHEBI:90152) has functional parent menaquinone-4 (CHEBI:78277) |
| ω-hydroxymenaquinone-4 (CHEBI:78278) has functional parent menaquinone-4 (CHEBI:78277) |
| IUPAC Name |
|---|
| 2-methyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]-1,4-naphthoquinone |
| INNs | Source |
|---|---|
| menatetrenona | WHO MedNet |
| menatetrenone | WHO MedNet |
| ménatétrénone | WHO MedNet |
| menatetrenonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-(3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl)-1,4-naphthoquinone | ChemIDplus |
| 2-Methyl-3-geranylgeranyl-1,4-naphthoquinone | ChemIDplus |
| 2-Methyl-3-trans-tetraprenyl-1,4-naphthoquinone | ChemIDplus |
| menaquinone 4 | ChEBI |
| Menaquinone K4 | ChemIDplus |
| MK-4 | MetaCyc |
| UniProt Name | Source |
|---|---|
| menaquinone-4 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1685 | DrugCentral |
| 4445530 | ChemSpider |
| CPD-9726 | MetaCyc |
| D00100 | KEGG DRUG |
| DB12148 | DrugBank |
| FDB029792 | FooDB |
| HMDB0030017 | HMDB |
| Menatetrenone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2178866 | Reaxys |
| CAS:863-61-6 | ChemIDplus |
| Citations |
|---|