EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H40O2 |
| Net Charge | 0 |
| Average Mass | 444.659 |
| Monoisotopic Mass | 444.30283 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC1=C(C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H40O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,12,14,16,18-20H,9-11,13,15,17,21H2,1-6H3/b23-14+,24-16+,25-20+ |
| InChIKey | DKHGMERMDICWDU-GHDNBGIDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000118) | PubMed (32086127) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| menaquinone-4 (CHEBI:78277) has role anti-inflammatory agent (CHEBI:67079) |
| menaquinone-4 (CHEBI:78277) has role antioxidant (CHEBI:22586) |
| menaquinone-4 (CHEBI:78277) has role bone density conservation agent (CHEBI:50646) |
| menaquinone-4 (CHEBI:78277) has role human metabolite (CHEBI:77746) |
| menaquinone-4 (CHEBI:78277) has role neuroprotective agent (CHEBI:63726) |
| menaquinone-4 (CHEBI:78277) is a menaquinone (CHEBI:16374) |
| Incoming Relation(s) |
| 2,3-epoxymenatetrenone (CHEBI:90152) has functional parent menaquinone-4 (CHEBI:78277) |
| ω-hydroxymenaquinone-4 (CHEBI:78278) has functional parent menaquinone-4 (CHEBI:78277) |
| IUPAC Name |
|---|
| 2-methyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]-1,4-naphthoquinone |
| INNs | Source |
|---|---|
| menatetrenona | WHO MedNet |
| menatetrenone | WHO MedNet |
| ménatétrénone | WHO MedNet |
| menatetrenonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-(3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl)-1,4-naphthoquinone | ChemIDplus |
| 2-Methyl-3-geranylgeranyl-1,4-naphthoquinone | ChemIDplus |
| 2-Methyl-3-trans-tetraprenyl-1,4-naphthoquinone | ChemIDplus |
| menaquinone 4 | ChEBI |
| Menaquinone K4 | ChemIDplus |
| MK-4 | MetaCyc |
| UniProt Name | Source |
|---|---|
| menaquinone-4 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1685 | DrugCentral |
| 4445530 | ChemSpider |
| CPD-9726 | MetaCyc |
| D00100 | KEGG DRUG |
| DB12148 | DrugBank |
| FDB029792 | FooDB |
| HMDB0030017 | HMDB |
| Menatetrenone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2178866 | Reaxys |
| CAS:863-61-6 | ChemIDplus |
| Citations |
|---|