EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@]12CCC3=C[C@](C)(C=C)CC[C@@]3(O)[C@]1(C)CC[C@@H](O)C2(C)C |
| InChI | InChI=1S/C20H32O2/c1-6-18(4)11-12-20(22)14(13-18)7-8-15-17(2,3)16(21)9-10-19(15,20)5/h6,13,15-16,21-22H,1,7-12H2,2-5H3/t15-,16-,18-,19-,20+/m1/s1 |
| InChIKey | RGLTYROISYBKIW-BDUQCRIQSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oryzalexin E (CHEBI:78259) has role plant metabolite (CHEBI:76924) |
| oryzalexin E (CHEBI:78259) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (3α,5β,9β,10α)-pimara-8(14),15-diene-3,9-diol |
| Synonyms | Source |
|---|---|
| ent-sandaracopimaradien-3α,7β-diol | SUBMITTER |
| 3α,9β-dihydroxy-ent-sandaracopimaradiene | ChEBI |
| UniProt Name | Source |
|---|---|
| oryzalexin E | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16611 | MetaCyc |
| HMDB0039702 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:150943-96-7 | HMDB |
| Citations |
|---|