EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O |
| Net Charge | 0 |
| Average Mass | 288.475 |
| Monoisotopic Mass | 288.24532 |
| SMILES | [H][C@@]12CC[C@@](C)(C=C)C=C1CC[C@]1([H])C(C)(C)[C@H](O)CC[C@@]21C |
| InChI | InChI=1S/C20H32O/c1-6-19(4)11-9-15-14(13-19)7-8-16-18(2,3)17(21)10-12-20(15,16)5/h6,13,15-17,21H,1,7-12H2,2-5H3/t15-,16-,17-,19-,20+/m1/s1 |
| InChIKey | ATQOOBSXQVRQPY-GNVJSZRZSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3α-hydroxy-ent-sandaracopimaradiene (CHEBI:78255) has role plant metabolite (CHEBI:76924) |
| 3α-hydroxy-ent-sandaracopimaradiene (CHEBI:78255) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (3α,5β,9β,10α)-pimara-8(14),15-dien-3-ol |
| UniProt Name | Source |
|---|---|
| ent-sandaracopimaradien-3β-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16610 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5276845 | Reaxys |
| Citations |
|---|