EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9O3 |
| Net Charge | -1 |
| Average Mass | 201.201 |
| Monoisotopic Mass | 201.05572 |
| SMILES | Cc1cccc2c(C(=O)[O-])cc(O)cc12 |
| InChI | InChI=1S/C12H10O3/c1-7-3-2-4-9-10(7)5-8(13)6-11(9)12(14)15/h2-6,13H,1H3,(H,14,15)/p-1 |
| InChIKey | XHCQZAMDSPGKMT-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseofuscus (ncbitaxon:146922) | - | PubMed (20485749) | |
| Streptomyces sahachiroi (ncbitaxon:285525) | - | PubMed (20485749) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-5-methyl-1-naphthoate (CHEBI:78252) has role bacterial metabolite (CHEBI:76969) |
| 3-hydroxy-5-methyl-1-naphthoate (CHEBI:78252) is a naphthoate (CHEBI:25482) |
| 3-hydroxy-5-methyl-1-naphthoate (CHEBI:78252) is conjugate base of 3-hydroxy-5-methyl-1-naphthoic acid (CHEBI:79083) |
| Incoming Relation(s) |
| 3-hydroxy-5-methyl-1-naphthoic acid (CHEBI:79083) is conjugate acid of 3-hydroxy-5-methyl-1-naphthoate (CHEBI:78252) |
| IUPAC Name |
|---|
| 3-hydroxy-5-methyl-1-naphthoate |
| Synonym | Source |
|---|---|
| 3-hydroxy-5-methyl-1-naphthalenecarboxylate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-hydroxy-5-methyl-1-naphthoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16515 | MetaCyc |
| Citations |
|---|