EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13Cl4N3O |
| Net Charge | 0 |
| Average Mass | 429.134 |
| Monoisotopic Mass | 426.98127 |
| SMILES | Clc1ccc(CO/N=C(\Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl4N3O/c19-13-2-1-12(16(21)7-13)10-26-24-18(9-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22/h1-8,11H,9-10H2/b24-18+ |
| InChIKey | QRJJEGAJXVEBNE-HKOYGPOVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxiconazole (CHEBI:7825) has role antiinfective agent (CHEBI:35441) |
| oxiconazole (CHEBI:7825) is a conazole antifungal drug (CHEBI:87071) |
| oxiconazole (CHEBI:7825) is a dichlorobenzene (CHEBI:23697) |
| oxiconazole (CHEBI:7825) is a imidazole antifungal drug (CHEBI:87069) |
| oxiconazole (CHEBI:7825) is a imidazoles (CHEBI:24780) |
| oxiconazole (CHEBI:7825) is a oxime O-ether (CHEBI:36816) |
| oxiconazole (CHEBI:7825) is conjugate base of oxiconazole(1+) (CHEBI:77698) |
| Incoming Relation(s) |
| oxiconazole(1+) (CHEBI:77698) is conjugate acid of oxiconazole (CHEBI:7825) |
| IUPAC Name |
|---|
| (1Z)-N-[(2,4-dichlorobenzyl)oxy]-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanimine |
| INNs | Source |
|---|---|
| oxiconazol | WHO MedNet |
| oxiconazole | WHO MedNet |
| oxiconazole | WHO MedNet |
| oxiconazolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2',4'-Dichloro-2-imidazol-1-ylacetophenone (Z)-[O-(2,4-dichlorobenzyl)oxime] | ChemIDplus |
| Ro 13-8996 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3408 | DrugCentral |
| C08074 | KEGG COMPOUND |
| D08313 | KEGG DRUG |
| DB00239 | DrugBank |
| HMDB0014384 | HMDB |
| Oxiconazole | Wikipedia |
| US4550175 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6004213 | Reaxys |
| CAS:64211-45-6 | ChemIDplus |
| CAS:64211-45-6 | KEGG COMPOUND |
| Citations |
|---|