EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O2 |
| Net Charge | 0 |
| Average Mass | 252.273 |
| Monoisotopic Mass | 252.08988 |
| SMILES | NC(=O)N1c2ccccc2CC(=O)c2ccccc21 |
| InChI | InChI=1S/C15H12N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8H,9H2,(H2,16,19) |
| InChIKey | CTRLABGOLIVAIY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. drug allergen Any drug which causes the onset of an allergic reaction. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticonvulsant A drug used to prevent seizures or reduce their severity. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxcarbazepine (CHEBI:7824) has part carbamoyl group (CHEBI:23004) |
| oxcarbazepine (CHEBI:7824) has role anticonvulsant (CHEBI:35623) |
| oxcarbazepine (CHEBI:7824) has role antidepressant (CHEBI:35469) |
| oxcarbazepine (CHEBI:7824) has role antineoplastic agent (CHEBI:35610) |
| oxcarbazepine (CHEBI:7824) has role antipsychotic agent (CHEBI:35476) |
| oxcarbazepine (CHEBI:7824) has role anxiolytic drug (CHEBI:35474) |
| oxcarbazepine (CHEBI:7824) has role drug allergen (CHEBI:88188) |
| oxcarbazepine (CHEBI:7824) has role immunosuppressive agent (CHEBI:35705) |
| oxcarbazepine (CHEBI:7824) is a cyclic ketone (CHEBI:3992) |
| oxcarbazepine (CHEBI:7824) is a dibenzoazepine (CHEBI:47804) |
| IUPAC Name |
|---|
| 10-oxo-10,11-dihydro-5H-dibenzo[b,f]azepine-5-carboxamide |
| INNs | Source |
|---|---|
| oxcarbazepina | ChemIDplus |
| oxcarbazepine | ChemIDplus |
| oxcarbazepinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10,11-Dihydro-10-oxo-5H-dibenz(b,f)azepine-5-carboxamide | ChemIDplus |
| GP-47680 | ChEMBL |
| KIN-493 | ChEMBL |
| NSC-758693 | ChEMBL |
| Oxcarbamazepine | ChEMBL |
| Oxcarbazepine | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Oxtellar xr | ChEMBL |
| Trileptal | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:28721-07-5 | ChemIDplus |
| CAS:28721-07-5 | KEGG COMPOUND |
| Citations |
|---|