EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O2 |
| Net Charge | 0 |
| Average Mass | 252.273 |
| Monoisotopic Mass | 252.08988 |
| SMILES | NC(=O)N1c2ccccc2CC(=O)c2ccccc21 |
| InChI | InChI=1S/C15H12N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8H,9H2,(H2,16,19) |
| InChIKey | CTRLABGOLIVAIY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxcarbazepine (CHEBI:7824) has part carbamoyl group (CHEBI:23004) |
| oxcarbazepine (CHEBI:7824) has role anticonvulsant (CHEBI:35623) |
| oxcarbazepine (CHEBI:7824) has role drug allergen (CHEBI:88188) |
| oxcarbazepine (CHEBI:7824) is a cyclic ketone (CHEBI:3992) |
| oxcarbazepine (CHEBI:7824) is a dibenzoazepine (CHEBI:47804) |
| IUPAC Name |
|---|
| 10-oxo-10,11-dihydro-5H-dibenzo[b,f]azepine-5-carboxamide |
| INNs | Source |
|---|---|
| oxcarbazepinum | ChemIDplus |
| oxcarbazepina | ChemIDplus |
| oxcarbazepine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Oxcarbazepine | KEGG COMPOUND |
| 10,11-Dihydro-10-oxo-5H-dibenz(b,f)azepine-5-carboxamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:28721-07-5 | KEGG COMPOUND |
| CAS:28721-07-5 | ChemIDplus |
| Citations |
|---|