EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8NO3S |
| Net Charge | -1 |
| Average Mass | 162.190 |
| Monoisotopic Mass | 162.02304 |
| SMILES | CC(=O)N[C@@H](CS)C(=O)[O-] |
| InChI | InChI=1S/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/p-1/t4-/m0/s1 |
| InChIKey | PWKSKIMOESPYIA-BYPYZUCNSA-M |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. vulnerary A drug used in treating and healing of wounds. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. antidote to paracetamol poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of paracetamol (acetaminophen). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-cysteinate (CHEBI:78236) has role antidote to paracetamol poisoning (CHEBI:74529) |
| N-acetyl-L-cysteinate (CHEBI:78236) has role antiinfective agent (CHEBI:35441) |
| N-acetyl-L-cysteinate (CHEBI:78236) has role antioxidant (CHEBI:22586) |
| N-acetyl-L-cysteinate (CHEBI:78236) has role antiviral drug (CHEBI:36044) |
| N-acetyl-L-cysteinate (CHEBI:78236) has role human metabolite (CHEBI:77746) |
| N-acetyl-L-cysteinate (CHEBI:78236) has role mucolytic (CHEBI:77034) |
| N-acetyl-L-cysteinate (CHEBI:78236) has role vulnerary (CHEBI:73336) |
| N-acetyl-L-cysteinate (CHEBI:78236) is a N-acetyl-L-α-amino acid anion (CHEBI:233443) |
| N-acetyl-L-cysteinate (CHEBI:78236) is a monocarboxylic acid anion (CHEBI:35757) |
| N-acetyl-L-cysteinate (CHEBI:78236) is conjugate base of N-acetyl-L-cysteine (CHEBI:28939) |
| Incoming Relation(s) |
| S-substituted N-acetyl-L-cysteinate (CHEBI:58718) has functional parent N-acetyl-L-cysteinate (CHEBI:78236) |
| N-acetyl-L-cysteine (CHEBI:28939) is conjugate acid of N-acetyl-L-cysteinate (CHEBI:78236) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-sulfanylpropanoate |
| UniProt Name | Source |
|---|---|
| N-acetyl-L-cysteine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9175 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6327823 | Reaxys |
| Citations |
|---|