EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N5O |
| Net Charge | 0 |
| Average Mass | 151.129 |
| Monoisotopic Mass | 151.04941 |
| SMILES | ONc1ncnc2ncnc12 |
| InChI | InChI=1S/C5H5N5O/c11-10-5-3-4(7-1-6-3)8-2-9-5/h1-2,11H,(H2,6,7,8,9,10) |
| InChIKey | CBCQWVQNMGNYEO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-hydroxyadenine (CHEBI:78235) has functional parent adenine (CHEBI:16708) |
| N6-hydroxyadenine (CHEBI:78235) has role mutagen (CHEBI:25435) |
| N6-hydroxyadenine (CHEBI:78235) has role teratogenic agent (CHEBI:50905) |
| N6-hydroxyadenine (CHEBI:78235) is a 6-aminopurines (CHEBI:20706) |
| N6-hydroxyadenine (CHEBI:78235) is a hydroxylamines (CHEBI:24709) |
| N6-hydroxyadenine (CHEBI:78235) is a nucleobase analogue (CHEBI:67142) |
| IUPAC Name |
|---|
| N-hydroxy-1H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 6-Hydroxyaminopurine | ChemIDplus |
| 6-Hydroxylaminopurine | ChemIDplus |
| 6-N-Hydroxylaminopurine | ChemIDplus |
| HAP | ChemIDplus |
| N(6)-Hydroxyadenine | ChemIDplus |
| N-(7H-purin-6-yl)hydroxylamine | MetaCyc |
| UniProt Name | Source |
|---|---|
| N6-hydroxyadenine | UniProt |
| Citations |
|---|