EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N5O |
| Net Charge | 0 |
| Average Mass | 151.129 |
| Monoisotopic Mass | 151.04941 |
| SMILES | ONc1ncnc2ncnc12 |
| InChI | InChI=1S/C5H5N5O/c11-10-5-3-4(7-1-6-3)8-2-9-5/h1-2,11H,(H2,6,7,8,9,10) |
| InChIKey | CBCQWVQNMGNYEO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-hydroxyadenine (CHEBI:78235) has functional parent adenine (CHEBI:16708) |
| N6-hydroxyadenine (CHEBI:78235) has role mutagen (CHEBI:25435) |
| N6-hydroxyadenine (CHEBI:78235) has role teratogenic agent (CHEBI:50905) |
| N6-hydroxyadenine (CHEBI:78235) is a 6-aminopurines (CHEBI:20706) |
| N6-hydroxyadenine (CHEBI:78235) is a hydroxylamines (CHEBI:24709) |
| N6-hydroxyadenine (CHEBI:78235) is a nucleobase analogue (CHEBI:67142) |
| IUPAC Name |
|---|
| N-hydroxy-1H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 6-Hydroxyaminopurine | ChemIDplus |
| 6-Hydroxylaminopurine | ChemIDplus |
| 6-N-Hydroxylaminopurine | ChemIDplus |
| HAP | ChemIDplus |
| N(6)-Hydroxyadenine | ChemIDplus |
| N-(7H-purin-6-yl)hydroxylamine | MetaCyc |
| UniProt Name | Source |
|---|---|
| N6-hydroxyadenine | UniProt |
| Citations |
|---|