EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7822 - oxaprozin
| Formula | C18H15NO3 |
| Net Charge | 0 |
| Average Mass | 293.322 |
| Monoisotopic Mass | 293.10519 |
| SMILES | O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21) |
| InChIKey | OFPXSFXSNFPTHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxaprozin (CHEBI:7822) has functional parent propionic acid (CHEBI:30768) |
| oxaprozin (CHEBI:7822) has role analgesic (CHEBI:35480) |
| oxaprozin (CHEBI:7822) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| oxaprozin (CHEBI:7822) is a 1,3-oxazoles (CHEBI:46812) |
| oxaprozin (CHEBI:7822) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid |
| INNs | Source |
|---|---|
| oxaprozin | ChemIDplus |
| oxaprozina | ChemIDplus |
| oxaprozine | ChemIDplus |
| oxaprozinum | ChemIDplus |
| Brand Names | Source |
|---|---|
| Danoprox | ChEBI |
| Daypro | KEGG DRUG |
| Dayrun | ChEBI |
| Deflam | ChEBI |
| Duraprox | ChEBI |
| Walix | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1083168 | Reaxys |
| CAS:21256-18-8 | KEGG COMPOUND |
| CAS:21256-18-8 | ChemIDplus |
| Citations |
|---|