EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7822 - oxaprozin
| Formula | C18H15NO3 |
| Net Charge | 0 |
| Average Mass | 293.322 |
| Monoisotopic Mass | 293.10519 |
| SMILES | O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21) |
| InChIKey | OFPXSFXSNFPTHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxaprozin (CHEBI:7822) has functional parent propionic acid (CHEBI:30768) |
| oxaprozin (CHEBI:7822) has role analgesic (CHEBI:35480) |
| oxaprozin (CHEBI:7822) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| oxaprozin (CHEBI:7822) is a 1,3-oxazoles (CHEBI:46812) |
| oxaprozin (CHEBI:7822) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid |
| INNs | Source |
|---|---|
| oxaprozin | ChemIDplus |
| oxaprozine | ChemIDplus |
| oxaprozinum | ChemIDplus |
| oxaprozina | ChemIDplus |
| Brand Names | Source |
|---|---|
| Daypro | KEGG DRUG |
| Danoprox | ChEBI |
| Walix | ChEBI |
| Duraprox | ChEBI |
| Dayrun | ChEBI |
| Deflam | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1083168 | Reaxys |
| CAS:21256-18-8 | KEGG COMPOUND |
| CAS:21256-18-8 | ChemIDplus |
| Citations |
|---|