EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:78217 - acetone d6
| Formula | C3D6O |
| Net Charge | 0 |
| Average Mass | 64.117 |
| Monoisotopic Mass | 64.07953 |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3/i1D3,2D3 |
| InChIKey | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | NMR solvent A solvent used in nuclear magnetic resonance (NMR) spectroscopy. polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Applications: | NMR solvent A solvent used in nuclear magnetic resonance (NMR) spectroscopy. polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetone d6 (CHEBI:78217) has role NMR solvent (CHEBI:197449) |
| acetone d6 (CHEBI:78217) has role polar aprotic solvent (CHEBI:48358) |
| acetone d6 (CHEBI:78217) is a deuterated compound (CHEBI:76107) |
| acetone d6 (CHEBI:78217) is a propanones (CHEBI:26292) |
| IUPAC Name |
|---|
| (2H6)propan-2-one |
| Synonyms | Source |
|---|---|
| (2H6)Acetone | ChemIDplus |
| 2-Propanone-1,1,1,3,3,3-D6 | NIST Chemistry WebBook |
| Acetone-d6 | ChemIDplus |
| (CD3)2CO | NIST Chemistry WebBook |
| hexadeuteroacetone | ChEBI |
| Perdeuteroacetone | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Deuterated_acetone | Wikipedia |