EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10N2O2 |
| Net Charge | 0 |
| Average Mass | 202.213 |
| Monoisotopic Mass | 202.07423 |
| SMILES | [NH3+]/C(=C\c1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C11H10N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-6,13H,12H2,(H,14,15)/b9-5- |
| InChIKey | HXAJMKJPBQFASJ-UITAMQMPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α,β-didehydrotryptophan zwitterion (CHEBI:78216) is a amino-acid zwitterion (CHEBI:35238) |
| α,β-didehydrotryptophan zwitterion (CHEBI:78216) is tautomer of 2-iminio-3-(indol-3-yl)propanoate (CHEBI:59193) |
| α,β-didehydrotryptophan zwitterion (CHEBI:78216) is tautomer of α,β-didehydrotryptophan (CHEBI:15802) |
| Incoming Relation(s) |
| 2-iminio-3-(indol-3-yl)propanoate (CHEBI:59193) is tautomer of α,β-didehydrotryptophan zwitterion (CHEBI:78216) |
| α,β-didehydrotryptophan (CHEBI:15802) is tautomer of α,β-didehydrotryptophan zwitterion (CHEBI:78216) |
| IUPAC Name |
|---|
| (2Z)-2-azaniumyl-3-(1H-indol-3-yl)prop-2-enoate |
| UniProt Name | Source |
|---|---|
| α,β-didehydrotryptophan | UniProt |