EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7820 - oxandrolone
| Formula | C19H30O3 |
| Net Charge | 0 |
| Average Mass | 306.446 |
| Monoisotopic Mass | 306.21949 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4(C)O)[C@@]1(C)COC(=O)C2 |
| InChI | InChI=1S/C19H30O3/c1-17-11-22-16(20)10-12(17)4-5-13-14(17)6-8-18(2)15(13)7-9-19(18,3)21/h12-15,21H,4-11H2,1-3H3/t12-,13+,14-,15-,17-,18-,19-/m0/s1 |
| InChIKey | QSLJIVKCVHQPLV-PEMPUTJUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. vulnerary A drug used in treating and healing of wounds. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxandrolone (CHEBI:7820) has role anabolic agent (CHEBI:36413) |
| oxandrolone (CHEBI:7820) has role androgen (CHEBI:50113) |
| oxandrolone (CHEBI:7820) has role anti-anaemic agent (CHEBI:75835) |
| oxandrolone (CHEBI:7820) has role anti-ulcer drug (CHEBI:49201) |
| oxandrolone (CHEBI:7820) has role antineoplastic agent (CHEBI:35610) |
| oxandrolone (CHEBI:7820) has role vulnerary (CHEBI:73336) |
| oxandrolone (CHEBI:7820) is a 17β-hydroxy steroid (CHEBI:35343) |
| oxandrolone (CHEBI:7820) is a 3-oxo steroid (CHEBI:47788) |
| oxandrolone (CHEBI:7820) is a anabolic androgenic steroid (CHEBI:50786) |
| oxandrolone (CHEBI:7820) is a oxa-steroid (CHEBI:50917) |
| IUPAC Name |
|---|
| 17β-hydroxy-17α-methyl-2-oxa-5α-androstan-3-one |
| INNs | Source |
|---|---|
| oxandrolona | ChemIDplus |
| oxandrolone | KEGG DRUG |
| oxandrolonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| NSC-67068 | ChEMBL |
| Oxandrolone | KEGG COMPOUND |
| Oxandrolone ciii | ChEMBL |
| Provitar | ChEMBL |
| SC 11585 | ChEMBL |
| SC-11585 | ChEMBL |
| Brand Name | Source |
|---|---|
| Oxandrin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2011 | DrugCentral |
| D00462 | KEGG DRUG |
| DB00621 | DrugBank |
| Oxandrolone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5480667 | Beilstein |
| Citations |
|---|