EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO7PR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 242.144 |
| Monoisotopic Mass (excl. R groups) | 242.04296 |
| SMILES | *C(=O)OCC(O)COP(=O)([O-])OCC[NH3+] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-acylglycerophosphoethanolamine zwitterion (CHEBI:78170) is a monoacylglycero-3-phosphoethanolamine zwitterion (CHEBI:78201) |
| 1-acylglycerophosphoethanolamine zwitterion (CHEBI:78170) is tautomer of 1-O-acylglycerophosphoethanolamine (CHEBI:55493) |
| Incoming Relation(s) |
| 1-acyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:64381) is a 1-acylglycerophosphoethanolamine zwitterion (CHEBI:78170) |
| 1-O-acylglycerophosphoethanolamine (CHEBI:55493) is tautomer of 1-acylglycerophosphoethanolamine zwitterion (CHEBI:78170) |