EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O3 |
| Net Charge | 0 |
| Average Mass | 258.317 |
| Monoisotopic Mass | 258.12559 |
| SMILES | CO/C=C(C(=O)OC)\C(C)=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H18O3/c1-13(15(12-18-2)16(17)19-3)8-7-11-14-9-5-4-6-10-14/h4-12H,1-3H3/b11-7+,13-8-,15-12+ |
| InChIKey | JSCQSBGXKRTPHZ-SYKZHUKTSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mucidin (CHEBI:78156) has role antifungal agent (CHEBI:35718) |
| mucidin (CHEBI:78156) has role fungal metabolite (CHEBI:76946) |
| mucidin (CHEBI:78156) is a enoate ester (CHEBI:51702) |
| mucidin (CHEBI:78156) is a enol ether (CHEBI:47985) |
| IUPAC Name |
|---|
| methyl (2E,3Z,5E)-2-(methoxymethylene)-3-methyl-6-phenylhexa-3,5-dienoate |
| Synonyms | Source |
|---|---|
| Mucidermin | HMDB |
| Strobilurin A | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030420 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4684438 | Reaxys |
| CAS:52110-55-1 | ChemIDplus |
| Citations |
|---|