EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O5 |
| Net Charge | 0 |
| Average Mass | 132.071 |
| Monoisotopic Mass | 132.00587 |
| SMILES | O=C(O)CC(=O)C(=O)O |
| InChI | InChI=1S/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9) |
| InChIKey | KHPXUQMNIQBQEV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxaloacetic acid (CHEBI:30744) has functional parent succinic acid (CHEBI:15741) |
| oxaloacetic acid (CHEBI:30744) has role geroprotector (CHEBI:176497) |
| oxaloacetic acid (CHEBI:30744) has role metabolite (CHEBI:25212) |
| oxaloacetic acid (CHEBI:30744) is a C4-dicarboxylic acid (CHEBI:66873) |
| oxaloacetic acid (CHEBI:30744) is a oxo dicarboxylic acid (CHEBI:36145) |
| oxaloacetic acid (CHEBI:30744) is conjugate acid of oxaloacetate(2−) (CHEBI:16452) |
| Incoming Relation(s) |
| oxaloacetic acid 4-methyl ester (CHEBI:16859) has functional parent oxaloacetic acid (CHEBI:30744) |
| oxaloacetate(2−) (CHEBI:16452) is conjugate base of oxaloacetic acid (CHEBI:30744) |
| IUPAC Name |
|---|
| 2-oxobutanedioic acid |
| Synonyms | Source |
|---|---|
| 2-Oxobutanedioic acid | KEGG COMPOUND |
| 2-oxosuccinic acid | NIST Chemistry WebBook |
| 3-carboxy-3-oxopropanoic acid | IUPAC |
| keto-succinic acid | ChEBI |
| ketosuccinic acid | NIST Chemistry WebBook |
| OAA | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00001197 | KNApSAcK |
| C00036 | KEGG COMPOUND |
| HMDB0000223 | HMDB |
| LMFA01170061 | LIPID MAPS |
| OAA | PDBeChem |
| OXALACETIC_ACID | MetaCyc |
| Oxaloacetic_acid | Wikipedia |
| US2011064679 | Patent |
| Citations |
|---|