EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O4 |
| Net Charge | -1 |
| Average Mass | 333.448 |
| Monoisotopic Mass | 333.20713 |
| SMILES | CC/C=C\C/C=C\CC(/C=C/C=C\C/C=C\CCCC(=O)[O-])OO |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h3-4,7-11,13-14,17,19,23H,2,5-6,12,15-16,18H2,1H3,(H,21,22)/p-1/b4-3-,9-7-,11-8-,13-10-,17-14+ |
| InChIKey | HDMYXONNVAOHFR-QGQBRVLBSA-M |
| Roles Classification |
|---|
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-HPEPE(1−) (CHEBI:78078) has functional parent all-cis-5,8,11,14,17-icosapentaenoate (CHEBI:58562) |
| 12-HPEPE(1−) (CHEBI:78078) has role platelet aggregation inhibitor (CHEBI:50427) |
| 12-HPEPE(1−) (CHEBI:78078) is a hydroperoxyicosapentaenoate (CHEBI:131876) |
| 12-HPEPE(1−) (CHEBI:78078) is conjugate base of 12-HPEPE (CHEBI:78909) |
| Incoming Relation(s) |
| 12(S)-HpEPE(1−) (CHEBI:90772) is a 12-HPEPE(1−) (CHEBI:78078) |
| 12-HPEPE (CHEBI:78909) is conjugate acid of 12-HPEPE(1−) (CHEBI:78078) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,14Z,17Z)-12-hydroperoxyicosa-5,8,10,14,17-pentaenoate |
| Synonym | Source |
|---|---|
| (5Z,8Z,10E,14Z,17Z)-12-hydroperoxyicosapentaenoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (5Z,7Z,8Z,10E,14Z,17Z)-12-hydroperoxyeicosapentaenoate | UniProt |