EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6FNO2 |
| Net Charge | 0 |
| Average Mass | 155.128 |
| Monoisotopic Mass | 155.03826 |
| SMILES | Nc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C7H6FNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | FPQMGQZTBWIHDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-fluoroanthranilic acid (CHEBI:78042) has functional parent anthranilic acid (CHEBI:30754) |
| 5-fluoroanthranilic acid (CHEBI:78042) has role antimetabolite (CHEBI:35221) |
| 5-fluoroanthranilic acid (CHEBI:78042) is a aminobenzoic acid (CHEBI:22495) |
| 5-fluoroanthranilic acid (CHEBI:78042) is a organofluorine compound (CHEBI:37143) |
| Synonym | Source |
|---|---|
| 2-amino-5-fluorobenzoic acid | ChEBI |
| Citations |
|---|