EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N6O |
| Net Charge | 0 |
| Average Mass | 396.454 |
| Monoisotopic Mass | 396.16986 |
| SMILES | Cc1cc(-c2ncc(CC(=O)Nc3ccc(-c4cnccn4)cn3)cc2C)ccn1 |
| InChI | InChI=1S/C23H20N6O/c1-15-9-17(12-28-23(15)18-5-6-25-16(2)10-18)11-22(30)29-21-4-3-19(13-27-21)20-14-24-7-8-26-20/h3-10,12-14H,11H2,1-2H3,(H,27,29,30) |
| InChIKey | XXYGTCZJJLTAGH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LGK974 (CHEBI:78030) has functional parent acetamide (CHEBI:27856) |
| LGK974 (CHEBI:78030) has role Wnt signalling inhibitor (CHEBI:78031) |
| LGK974 (CHEBI:78030) is a bipyridines (CHEBI:50511) |
| LGK974 (CHEBI:78030) is a pyrazines (CHEBI:38314) |
| LGK974 (CHEBI:78030) is a pyridines (CHEBI:26421) |
| LGK974 (CHEBI:78030) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-(2',3-dimethyl-2,4'-bipyridin-5-yl)-N-[5-(pyrazin-2-yl)pyridin-2-yl]acetamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20663778 | Reaxys |
| Citations |
|---|