EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N8.2HCl |
| Net Charge | 0 |
| Average Mass | 257.129 |
| Monoisotopic Mass | 256.07185 |
| SMILES | CC(/C=N/NC(=N)N)=N\NC(=N)N.Cl.Cl |
| InChI | InChI=1S/C5H12N8.2ClH/c1-3(11-13-5(8)9)2-10-12-4(6)7;;/h2H,1H3,(H4,6,7,12)(H4,8,9,13);2*1H/b10-2+,11-3+;; |
| InChIKey | VVTBQCXLZQYGQE-PVTAQEPXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 4.1.1.50 (adenosylmethionine decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of adenosylmethionine decarboxylase (EC 4.1.1.50). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitoguazone hydrochloride (CHEBI:78028) has part mitoguazone(2+) (CHEBI:78025) |
| mitoguazone hydrochloride (CHEBI:78028) has role antineoplastic agent (CHEBI:35610) |
| mitoguazone hydrochloride (CHEBI:78028) has role apoptosis inducer (CHEBI:68495) |
| mitoguazone hydrochloride (CHEBI:78028) has role EC 4.1.1.50 (adenosylmethionine decarboxylase) inhibitor (CHEBI:78024) |
| mitoguazone hydrochloride (CHEBI:78028) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| mitoguazone hydrochloride hydrate (CHEBI:78032) has part mitoguazone hydrochloride (CHEBI:78028) |
| IUPAC Names |
|---|
| (2E,2'E)-2,2'-(1E,2E)-propane-1,2-diylidenedihydrazinecarboximidamide dihydrochloride |
| [(1E,2E)-propane-1,2-diylidenedi(2E)hydrazin-1-yl-2-ylidene]bis(iminomethanaminium) dichloride |
| Synonyms | Source |
|---|---|
| Mitoguazone dihydrochloride | ChemIDplus |
| Mitoguazone HCl | ChemIDplus |
| Methylglyoxal bis(guanylhydrazone) dihydrochloride | ChemIDplus |
| Methylglyoxal bis(amidinohydrazone) dihydrochloride | ChemIDplus |
| mitoguazone.2HCl | ChEBI |
| MGGH | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Mitoguazone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13607962 | Reaxys |
| CAS:7059-23-6 | ChemIDplus |
| Citations |
|---|