EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)Cc1cc(O)cc(=O)o1 |
| InChI | InChI=1S/C15H12O5/c16-11-4-1-10(2-5-11)3-6-12(17)7-14-8-13(18)9-15(19)20-14/h1-6,8-9,16,18H,7H2/b6-3+ |
| InChIKey | ZUILKEWVWUKSAO-ZZXKWVIFSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-coumaroyltriacetic acid lactone (CHEBI:78023) has role plant metabolite (CHEBI:76924) |
| 4-coumaroyltriacetic acid lactone (CHEBI:78023) is a 2-pyranones (CHEBI:75885) |
| 4-coumaroyltriacetic acid lactone (CHEBI:78023) is a enone (CHEBI:51689) |
| 4-coumaroyltriacetic acid lactone (CHEBI:78023) is a phenols (CHEBI:33853) |
| 4-coumaroyltriacetic acid lactone (CHEBI:78023) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 4-hydroxy-6-[(3E)-4-(4-hydroxyphenyl)-2-oxobut-3-en-1-yl]-2H-pyran-2-one |
| Synonym | Source |
|---|---|
| p-Coumaroyltriacetic acid lactone | KEGG COMPOUND |
| Citations |
|---|