EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H16N2 |
| Net Charge | 0 |
| Average Mass | 332.406 |
| Monoisotopic Mass | 332.13135 |
| SMILES | c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18/h1-16H |
| InChIKey | DHDHJYNTEFLIHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,7-diphenyl-1,10-phenanthroline (CHEBI:77995) has role chelator (CHEBI:38161) |
| 4,7-diphenyl-1,10-phenanthroline (CHEBI:77995) is a benzenes (CHEBI:22712) |
| 4,7-diphenyl-1,10-phenanthroline (CHEBI:77995) is a phenanthrolines (CHEBI:48835) |
| Incoming Relation(s) |
| 4,7-diphenyl-1,10-phenanthroline 4',4''-disulfonic acid (CHEBI:78159) has parent hydride 4,7-diphenyl-1,10-phenanthroline (CHEBI:77995) |
| IUPAC Name |
|---|
| 4,7-diphenyl-1,10-phenanthroline |
| Synonyms | Source |
|---|---|
| 1,10-Bathophenanthroline | ChemIDplus |
| Bathophenanthrolin | ChemIDplus |
| Bathophenanthroline | ChemIDplus |
| Citations |
|---|