EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28N2O4.H3O4P |
| Net Charge | 0 |
| Average Mass | 410.404 |
| Monoisotopic Mass | 410.18180 |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1.O=P(O)(O)O |
| InChI | InChI=1S/C16H28N2O4.H3O4P/c1-5-12(6-2)22-14-9-11(16(20)21-7-3)8-13(17)15(14)18-10(4)19;1-5(2,3)4/h9,12-15H,5-8,17H2,1-4H3,(H,18,19);(H3,1,2,3,4)/t13-,14+,15+;/m0./s1 |
| InChIKey | PGZUMBJQJWIWGJ-ONAKXNSWSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oseltamivir phosphate (CHEBI:7799) has part oseltamivir (CHEBI:7798) |
| oseltamivir phosphate (CHEBI:7799) has role antiviral agent (CHEBI:22587) |
| oseltamivir phosphate (CHEBI:7799) has role renoprotective agent (CHEBI:231911) |
| oseltamivir phosphate (CHEBI:7799) is a phosphate salt (CHEBI:37853) |
| IUPAC Name |
|---|
| ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate phosphate |
| Synonyms | Source |
|---|---|
| (3R-(3α,4β,5α))-Ethyl 4-(acetylamino)-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate phosphate (1:1) | ChemIDplus |
| Ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate phosphate (1:1) | ChemIDplus |
| Oseltamivir (as phosphate) | ChEMBL |
| Oseltamiviri phosphas | ChEMBL |
| Oseltamivir phosphate | KEGG COMPOUND |
| RO 64-0796/002 | ChEMBL |
| Brand Name | Source |
|---|---|
| Tamiflu | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8101020 | Beilstein |
| CAS:204255-11-8 | ChemIDplus |
| Citations |
|---|