EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8I.Cl |
| Net Charge | 0 |
| Average Mass | 314.553 |
| Monoisotopic Mass | 313.93593 |
| SMILES | [Cl-].c1ccc2c(c1)[I+]c1ccccc1-2 |
| InChI | InChI=1S/C12H8I.ClH/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H/q+1;/p-1 |
| InChIKey | FCFZKAVCDNTYID-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | EC 1.6.3.1. [NAD(P)H oxidase (H2O2-forming)] inhibitor An EC 1.6.3.* (oxidoreductase acting on NADH or NADPH with oxygen as acceptor) inhibitor that interferes with the action of NAD(P)H oxidase (H2O2-forming), EC 1.6.3.1. G-protein-coupled receptor agonist An agonist that binds to and activates G-protein-coupled receptors |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenziodolium chloride (CHEBI:77967) has part dibenziodolium (CHEBI:77986) |
| dibenziodolium chloride (CHEBI:77967) has role EC 1.6.3.1. [NAD(P)H oxidase (H2O2-forming)] inhibitor (CHEBI:50423) |
| dibenziodolium chloride (CHEBI:77967) has role G-protein-coupled receptor agonist (CHEBI:70998) |
| dibenziodolium chloride (CHEBI:77967) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| dibenzo[b,d]iodolium chloride |
| Synonyms | Source |
|---|---|
| 2,2'-biphenylyleneiodonium chloride | ChEBI |
| Diphenyleneiodonium chloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3918620 | Reaxys |
| CAS:4673-26-1 | ChemIDplus |
| Citations |
|---|