EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O15 |
| Net Charge | 0 |
| Average Mass | 512.461 |
| Monoisotopic Mass | 512.17412 |
| SMILES | [H][C@]1([C@H](O)CO[C@]2(C(=O)OC)C[C@@H](O)[C@@H](O)[C@@]([H])([C@H](O)CO)O2)O[C@@](OCC=C)(C(=O)O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H32O15/c1-3-4-32-19(17(28)29)5-9(22)14(27)16(34-19)12(25)8-33-20(18(30)31-2)6-10(23)13(26)15(35-20)11(24)7-21/h3,9-16,21-27H,1,4-8H2,2H3,(H,28,29)/t9-,10-,11-,12-,13-,14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | LLIXJTAYHKDPLM-GSLZCSFCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-Kdo1Me-(2→8)-α-Kdo-OAll (CHEBI:77958) is a dicarboxylic acid monoester (CHEBI:36244) |
| α-Kdo1Me-(2→8)-α-Kdo-OAll (CHEBI:77958) is a disaccharide derivative (CHEBI:63353) |
| α-Kdo1Me-(2→8)-α-Kdo-OAll (CHEBI:77958) is a glycoside (CHEBI:24400) |
| α-Kdo1Me-(2→8)-α-Kdo-OAll (CHEBI:77958) is a methyl ester (CHEBI:25248) |
| α-Kdo1Me-(2→8)-α-Kdo-OAll (CHEBI:77958) is conjugate acid of α-Kdo1Me-(2→8)-α-Kdo-OAll(1−) (CHEBI:77959) |
| Incoming Relation(s) |
| α-Kdo1Me-(2→8)-α-Kdo-OAll(1−) (CHEBI:77959) is conjugate base of α-Kdo1Me-(2→8)-α-Kdo-OAll (CHEBI:77958) |
| IUPAC Name |
|---|
| (methyl 3-deoxy-α-D-manno-oct-2-ulopyranonosid)yl-(2→8)-(prop-2-en-1-yl 3-deoxy-α-D-manno-oct-2-ulopyranosid)onic acid |
| Synonyms | Source |
|---|---|
| 2-propen-1-yl 3-deoxy-8-O-(3-deoxy-1-methyl-α-D-manno-2-octulopyranosonosyl)-α-D-manno-2-octulopyranosidonic acid | ChEBI |
| allyl (6R)-3-deoxy-6-[(1R)-2-({(6R)-3-deoxy-6-[(1R)-1,2-dihydroxyethyl]-1-methyl-β-L-erythro-hex-2-ulopyranonosyl}oxy)-1-hydroxyethyl]-β-L-erythro-hex-2-ulopyranosidonic acid | IUPAC |
| Kdo-Me-(2→8)-Kdo allyl glycoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19681946 | Reaxys |
| CAS:1192747-37-7 | Reaxys |
| Citations |
|---|