EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10FNO2 |
| Net Charge | 0 |
| Average Mass | 183.182 |
| Monoisotopic Mass | 183.06956 |
| SMILES | N[C@@H](Cc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C9H10FNO2/c10-7-3-1-2-6(4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | VWHRYODZTDMVSS-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| m-fluoro-L-phenylalanine (CHEBI:77957) is a L-phenylalanine derivative (CHEBI:84144) |
| m-fluoro-L-phenylalanine (CHEBI:77957) is a monofluorobenzenes (CHEBI:83575) |
| m-fluoro-L-phenylalanine (CHEBI:77957) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 3-fluoro-L-phenylalanine |
| Synonyms | Source |
|---|---|
| 3-fluorophenylalanine | ChEBI |
| m-fluorophenylalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2725762 | Reaxys |
| Citations |
|---|