EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO3 |
| Net Charge | 0 |
| Average Mass | 267.284 |
| Monoisotopic Mass | 267.08954 |
| SMILES | COc1cccc(-c2cc(=O)c3ccccc3o2)c1N |
| InChI | InChI=1S/C16H13NO3/c1-19-14-8-4-6-11(16(14)17)15-9-12(18)10-5-2-3-7-13(10)20-15/h2-9H,17H2,1H3 |
| InChIKey | QFWCYNPOPKQOKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-amino-3-methoxyphenyl)chromen-4-one (CHEBI:77954) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| 2-(2-amino-3-methoxyphenyl)chromen-4-one (CHEBI:77954) has role geroprotector (CHEBI:176497) |
| 2-(2-amino-3-methoxyphenyl)chromen-4-one (CHEBI:77954) is a aromatic amine (CHEBI:33860) |
| 2-(2-amino-3-methoxyphenyl)chromen-4-one (CHEBI:77954) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| 2-(2-amino-3-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| PD 98,059 | ChemIDplus |
| PD 98059 | ChemIDplus |
| 2-(2-Amino-3-methoxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| 2'-amino-3'-methoxyflavone | ChEBI |
| PD-98059 | ChemIDplus |
| PD98059 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-3394 | LINCS |
| HMDB0244751 | HMDB |
| 4551 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8148190 | Reaxys |
| CAS:167869-21-8 | ChemIDplus |
| Citations |
|---|